C30H29F2N7O4 — CID 25071968
3-[1-ethyl-4-(oxan-4-ylamino)pyrazolo[3,4-b]pyridin-5-yl]-5-N,5-N'-bis(4-fluorophenyl)-4H-1,2-oxazole-5,5-dicarboxamide (PubChem CID 25071968) has the molecular formula C30H29F2N7O4 and a molecular weight of 589.60 g/mol. Its IUPAC name is 3-[1-ethyl-4-(oxan-4-ylamino)pyrazolo[3,4-b]pyridin-5-yl]-5-N,5-N'-bis(4-fluorophenyl)-4H-1,2-oxazole-5,5-dicarboxamide.
| Compound Name | 3-[1-ethyl-4-(oxan-4-ylamino)pyrazolo[3,4-b]pyridin-5-yl]-5-N,5-N'-bis(4-fluorophenyl)-4H-1,2-oxazole-5,5-dicarboxamide |
|---|---|
| PubChem CID | 25071968 |
| Molecular Formula | C30H29F2N7O4 |
| Molecular Weight | 589.60 g/mol |
| Exact Mass | 589.22 |
| IUPAC Name | 3-[1-ethyl-4-(oxan-4-ylamino)pyrazolo[3,4-b]pyridin-5-yl]-5-N,5-N'-bis(4-fluorophenyl)-4H-1,2-oxazole-5,5-dicarboxamide |
| SMILES | CCn1ncc2c(NC3CCOCC3)c(C3=NOC(C(=O)Nc4ccc(F)cc4)(C(=O)Nc4ccc(F)cc4)C3)cnc21 |
| InChI | InChI=1S/C30H29F2N7O4/c1-2-39-27-24(17-34-39)26(35-22-11-13-42-14-12-22)23(16-33-27)25-15-30(43-38-25,28(40)36-20-7-3-18(31)4-8-20)29(41)37-21-9-5-19(32)6-10-21/h3-10,16-17,22H,2,11-15H2,1H3,(H,33,35)(H,36,40)(H,37,41) |
| InChIKey | VZJDAYPXZRLERC-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 131.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.60 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|