C18H17FN4O4 — CID 25072118
methyl 5-(4-amino-2-fluoroanilino)-1,8-dimethyl-4,7-dioxo-1,8-naphthyridine-3-carboxylate (PubChem CID 25072118) has the molecular formula C18H17FN4O4 and a molecular weight of 372.36 g/mol. Its IUPAC name is methyl 5-(4-amino-2-fluoroanilino)-1,8-dimethyl-4,7-dioxo-1,8-naphthyridine-3-carboxylate.
| Compound Name | methyl 5-(4-amino-2-fluoroanilino)-1,8-dimethyl-4,7-dioxo-1,8-naphthyridine-3-carboxylate |
|---|---|
| PubChem CID | 25072118 |
| Molecular Formula | C18H17FN4O4 |
| Molecular Weight | 372.36 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | methyl 5-(4-amino-2-fluoroanilino)-1,8-dimethyl-4,7-dioxo-1,8-naphthyridine-3-carboxylate |
| SMILES | COC(=O)c1cn(C)c2c(c(Nc3ccc(N)cc3F)cc(=O)n2C)c1=O |
| InChI | InChI=1S/C18H17FN4O4/c1-22-8-10(18(26)27-3)16(25)15-13(7-14(24)23(2)17(15)22)21-12-5-4-9(20)6-11(12)19/h4-8,21H,20H2,1-3H3 |
| InChIKey | DJPUUVTWJULFJZ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 108.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.36 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|