About 6-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]pyrazolo[1,5-a]pyridine
6-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]pyrazolo[1,5-a]pyridine (PubChem CID 25072632) has the molecular formula C21H24Cl2N4O
and a molecular weight of 419.36 g/mol. Its IUPAC name is 6-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]pyrazolo[1,5-a]pyridine.
Molecular Properties
| Compound Name | 6-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]pyrazolo[1,5-a]pyridine |
| PubChem CID | 25072632 |
| Molecular Formula | C21H24Cl2N4O |
| Molecular Weight | 419.36 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | 6-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]pyrazolo[1,5-a]pyridine |
| SMILES | Clc1cccc(N2CCN(CCCCOc3ccc4ccnn4c3)CC2)c1Cl |
| InChI | InChI=1S/C21H24Cl2N4O/c22-19-4-3-5-20(21(19)23)26-13-11-25(12-14-26)10-1-2-15-28-18-7-6-17-8-9-24-27(17)16-18/h3-9,16H,1-2,10-15H2 |
| InChIKey | OUJRMAKUNWMZPB-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 33.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.36 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]pyrazolo[1,5-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]pyrazolo[1,5-a]pyridine?
The IUPAC name of 6-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]pyrazolo[1,5-a]pyridine (CID 25072632) is 6-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]pyrazolo[1,5-a]pyridine.
What is the SMILES notation for 6-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]pyrazolo[1,5-a]pyridine?
The canonical SMILES for 6-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]pyrazolo[1,5-a]pyridine is Clc1cccc(N2CCN(CCCCOc3ccc4ccnn4c3)CC2)c1Cl.
What is the InChIKey of 6-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]pyrazolo[1,5-a]pyridine?
The InChIKey is OUJRMAKUNWMZPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24Cl2N4O/c22-19-4-3-5-20(21(19)23)26-13-11-25(12-14-26)10-1-2-15-28-18-7-6-17-8-9-24-27(17)16-18/h3-9,16H,1-2,10-15H2.
What are the key properties of 6-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]pyrazolo[1,5-a]pyridine?
6-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]pyrazolo[1,5-a]pyridine has a molecular weight of 419.36 g/mol, XLogP of 4.62, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]pyrazolo[1,5-a]pyridine is sourced from PubChem (CID 25072632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).