C20H26BrN5OS — CID 25072748
2-(2-bromo-5-methoxyphenyl)sulfanyl-1-[2-(2,2-dimethylpropylamino)ethyl]imidazo[4,5-c]pyridin-4-amine (PubChem CID 25072748) has the molecular formula C20H26BrN5OS and a molecular weight of 464.43 g/mol. Its IUPAC name is 2-(2-bromo-5-methoxyphenyl)sulfanyl-1-[2-(2,2-dimethylpropylamino)ethyl]imidazo[4,5-c]pyridin-4-amine.
| Compound Name | 2-(2-bromo-5-methoxyphenyl)sulfanyl-1-[2-(2,2-dimethylpropylamino)ethyl]imidazo[4,5-c]pyridin-4-amine |
|---|---|
| PubChem CID | 25072748 |
| Molecular Formula | C20H26BrN5OS |
| Molecular Weight | 464.43 g/mol |
| Exact Mass | 463.10 |
| IUPAC Name | 2-(2-bromo-5-methoxyphenyl)sulfanyl-1-[2-(2,2-dimethylpropylamino)ethyl]imidazo[4,5-c]pyridin-4-amine |
| SMILES | COc1ccc(Br)c(Sc2nc3c(N)nccc3n2CCNCC(C)(C)C)c1 |
| InChI | InChI=1S/C20H26BrN5OS/c1-20(2,3)12-23-9-10-26-15-7-8-24-18(22)17(15)25-19(26)28-16-11-13(27-4)5-6-14(16)21/h5-8,11,23H,9-10,12H2,1-4H3,(H2,22,24) |
| InChIKey | PDQKUVATWDSROA-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.43 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|