C26H31N7O2 — CID 25072769
[3-[6-morpholin-4-yl-9-[1-(1H-pyrrol-2-ylmethyl)piperidin-4-yl]purin-2-yl]phenyl]methanol (PubChem CID 25072769) has the molecular formula C26H31N7O2 and a molecular weight of 473.58 g/mol. Its IUPAC name is [3-[6-morpholin-4-yl-9-[1-(1H-pyrrol-2-ylmethyl)piperidin-4-yl]purin-2-yl]phenyl]methanol.
| Compound Name | [3-[6-morpholin-4-yl-9-[1-(1H-pyrrol-2-ylmethyl)piperidin-4-yl]purin-2-yl]phenyl]methanol |
|---|---|
| PubChem CID | 25072769 |
| Molecular Formula | C26H31N7O2 |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.25 |
| IUPAC Name | [3-[6-morpholin-4-yl-9-[1-(1H-pyrrol-2-ylmethyl)piperidin-4-yl]purin-2-yl]phenyl]methanol |
| SMILES | OCc1cccc(-c2nc(N3CCOCC3)c3ncn(C4CCN(Cc5ccc[nH]5)CC4)c3n2)c1 |
| InChI | InChI=1S/C26H31N7O2/c34-17-19-3-1-4-20(15-19)24-29-25(32-11-13-35-14-12-32)23-26(30-24)33(18-28-23)22-6-9-31(10-7-22)16-21-5-2-8-27-21/h1-5,8,15,18,22,27,34H,6-7,9-14,16-17H2 |
| InChIKey | BTUWLMVKSGRZQQ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 95.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |