C19H22IN5O2S — CID 25073055
2-[(6-iodo-1,3-benzodioxol-5-yl)sulfanyl]-1-[3-(propan-2-ylamino)propyl]imidazo[4,5-c]pyridin-4-amine (PubChem CID 25073055) has the molecular formula C19H22IN5O2S and a molecular weight of 511.39 g/mol. Its IUPAC name is 2-[(6-iodo-1,3-benzodioxol-5-yl)sulfanyl]-1-[3-(propan-2-ylamino)propyl]imidazo[4,5-c]pyridin-4-amine.
| Compound Name | 2-[(6-iodo-1,3-benzodioxol-5-yl)sulfanyl]-1-[3-(propan-2-ylamino)propyl]imidazo[4,5-c]pyridin-4-amine |
|---|---|
| PubChem CID | 25073055 |
| Molecular Formula | C19H22IN5O2S |
| Molecular Weight | 511.39 g/mol |
| Exact Mass | 511.05 |
| IUPAC Name | 2-[(6-iodo-1,3-benzodioxol-5-yl)sulfanyl]-1-[3-(propan-2-ylamino)propyl]imidazo[4,5-c]pyridin-4-amine |
| SMILES | CC(C)NCCCn1c(Sc2cc3c(cc2I)OCO3)nc2c(N)nccc21 |
| InChI | InChI=1S/C19H22IN5O2S/c1-11(2)22-5-3-7-25-13-4-6-23-18(21)17(13)24-19(25)28-16-9-15-14(8-12(16)20)26-10-27-15/h4,6,8-9,11,22H,3,5,7,10H2,1-2H3,(H2,21,23) |
| InChIKey | FNNXIVAECASPAR-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.39 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|