About (3-bromofuran-2-yl)-(2,7-diazabicyclo[4.2.0]octan-7-yl)methanone
(3-bromofuran-2-yl)-(2,7-diazabicyclo[4.2.0]octan-7-yl)methanone (PubChem CID 25073238) has the molecular formula C11H13BrN2O2
and a molecular weight of 285.14 g/mol. Its IUPAC name is (3-bromofuran-2-yl)-(2,7-diazabicyclo[4.2.0]octan-7-yl)methanone.
Molecular Properties
| Compound Name | (3-bromofuran-2-yl)-(2,7-diazabicyclo[4.2.0]octan-7-yl)methanone |
| PubChem CID | 25073238 |
| Molecular Formula | C11H13BrN2O2 |
| Molecular Weight | 285.14 g/mol |
| Exact Mass | 284.02 |
| IUPAC Name | (3-bromofuran-2-yl)-(2,7-diazabicyclo[4.2.0]octan-7-yl)methanone |
| SMILES | O=C(c1occc1Br)N1CC2NCCCC21 |
| InChI | InChI=1S/C11H13BrN2O2/c12-7-3-5-16-10(7)11(15)14-6-8-9(14)2-1-4-13-8/h3,5,8-9,13H,1-2,4,6H2 |
| InChIKey | OVGJAGXLJAHCTD-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.14 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3-bromofuran-2-yl)-(2,7-diazabicyclo[4.2.0]octan-7-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-bromofuran-2-yl)-(2,7-diazabicyclo[4.2.0]octan-7-yl)methanone?
The IUPAC name of (3-bromofuran-2-yl)-(2,7-diazabicyclo[4.2.0]octan-7-yl)methanone (CID 25073238) is (3-bromofuran-2-yl)-(2,7-diazabicyclo[4.2.0]octan-7-yl)methanone.
What is the SMILES notation for (3-bromofuran-2-yl)-(2,7-diazabicyclo[4.2.0]octan-7-yl)methanone?
The canonical SMILES for (3-bromofuran-2-yl)-(2,7-diazabicyclo[4.2.0]octan-7-yl)methanone is O=C(c1occc1Br)N1CC2NCCCC21.
What is the InChIKey of (3-bromofuran-2-yl)-(2,7-diazabicyclo[4.2.0]octan-7-yl)methanone?
The InChIKey is OVGJAGXLJAHCTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13BrN2O2/c12-7-3-5-16-10(7)11(15)14-6-8-9(14)2-1-4-13-8/h3,5,8-9,13H,1-2,4,6H2.
What are the key properties of (3-bromofuran-2-yl)-(2,7-diazabicyclo[4.2.0]octan-7-yl)methanone?
(3-bromofuran-2-yl)-(2,7-diazabicyclo[4.2.0]octan-7-yl)methanone has a molecular weight of 285.14 g/mol, XLogP of 1.62, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-bromofuran-2-yl)-(2,7-diazabicyclo[4.2.0]octan-7-yl)methanone is sourced from PubChem (CID 25073238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).