About 4-azatricyclo[5.2.1.02,6]decan-3-one
4-azatricyclo[5.2.1.02,6]decan-3-one (PubChem CID 25073258) has the molecular formula C9H13NO
and a molecular weight of 151.21 g/mol. Its IUPAC name is 4-azatricyclo[5.2.1.02,6]decan-3-one.
Molecular Properties
| Compound Name | 4-azatricyclo[5.2.1.02,6]decan-3-one |
| PubChem CID | 25073258 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | 4-azatricyclo[5.2.1.02,6]decan-3-one |
| SMILES | O=C1NCC2C3CCC(C3)C12 |
| InChI | InChI=1S/C9H13NO/c11-9-8-6-2-1-5(3-6)7(8)4-10-9/h5-8H,1-4H2,(H,10,11) |
| InChIKey | WKXVMLDGXPRZRY-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-azatricyclo[5.2.1.02,6]decan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-azatricyclo[5.2.1.02,6]decan-3-one?
The IUPAC name of 4-azatricyclo[5.2.1.02,6]decan-3-one (CID 25073258) is 4-azatricyclo[5.2.1.02,6]decan-3-one.
What is the SMILES notation for 4-azatricyclo[5.2.1.02,6]decan-3-one?
The canonical SMILES for 4-azatricyclo[5.2.1.02,6]decan-3-one is O=C1NCC2C3CCC(C3)C12.
What is the InChIKey of 4-azatricyclo[5.2.1.02,6]decan-3-one?
The InChIKey is WKXVMLDGXPRZRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO/c11-9-8-6-2-1-5(3-6)7(8)4-10-9/h5-8H,1-4H2,(H,10,11).
What are the key properties of 4-azatricyclo[5.2.1.02,6]decan-3-one?
4-azatricyclo[5.2.1.02,6]decan-3-one has a molecular weight of 151.21 g/mol, XLogP of 0.78, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-azatricyclo[5.2.1.02,6]decan-3-one is sourced from PubChem (CID 25073258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).