C18H19IN4O3S — CID 25073666
2-[(6-iodo-1,3-benzodioxol-5-yl)sulfanyl]-1-(2-propan-2-yloxyethyl)imidazo[4,5-c]pyridin-4-amine (PubChem CID 25073666) has the molecular formula C18H19IN4O3S and a molecular weight of 498.35 g/mol. Its IUPAC name is 2-[(6-iodo-1,3-benzodioxol-5-yl)sulfanyl]-1-(2-propan-2-yloxyethyl)imidazo[4,5-c]pyridin-4-amine.
| Compound Name | 2-[(6-iodo-1,3-benzodioxol-5-yl)sulfanyl]-1-(2-propan-2-yloxyethyl)imidazo[4,5-c]pyridin-4-amine |
|---|---|
| PubChem CID | 25073666 |
| Molecular Formula | C18H19IN4O3S |
| Molecular Weight | 498.35 g/mol |
| Exact Mass | 498.02 |
| IUPAC Name | 2-[(6-iodo-1,3-benzodioxol-5-yl)sulfanyl]-1-(2-propan-2-yloxyethyl)imidazo[4,5-c]pyridin-4-amine |
| SMILES | CC(C)OCCn1c(Sc2cc3c(cc2I)OCO3)nc2c(N)nccc21 |
| InChI | InChI=1S/C18H19IN4O3S/c1-10(2)24-6-5-23-12-3-4-21-17(20)16(12)22-18(23)27-15-8-14-13(7-11(15)19)25-9-26-14/h3-4,7-8,10H,5-6,9H2,1-2H3,(H2,20,21) |
| InChIKey | LLOJOPCCWIFLJT-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.35 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|