C26H19NO4S2 — CID 25073863
N-[3-[2-hydroxy-6-(3-hydroxyphenyl)naphthalen-1-yl]phenyl]thiophene-2-sulfonamide (PubChem CID 25073863) has the molecular formula C26H19NO4S2 and a molecular weight of 473.58 g/mol. Its IUPAC name is N-[3-[2-hydroxy-6-(3-hydroxyphenyl)naphthalen-1-yl]phenyl]thiophene-2-sulfonamide.
| Compound Name | N-[3-[2-hydroxy-6-(3-hydroxyphenyl)naphthalen-1-yl]phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 25073863 |
| Molecular Formula | C26H19NO4S2 |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.08 |
| IUPAC Name | N-[3-[2-hydroxy-6-(3-hydroxyphenyl)naphthalen-1-yl]phenyl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1cccc(-c2c(O)ccc3cc(-c4cccc(O)c4)ccc23)c1)c1cccs1 |
| InChI | InChI=1S/C26H19NO4S2/c28-22-7-2-4-17(16-22)18-9-11-23-19(14-18)10-12-24(29)26(23)20-5-1-6-21(15-20)27-33(30,31)25-8-3-13-32-25/h1-16,27-29H |
| InChIKey | JISVMBXMEWXOEV-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |