C22H25ClF2N4O4S2 — CID 25074308
(2S)-2-[4-(4-chloro-2,5-difluorophenyl)sulfonyl-2-oxopiperazin-1-yl]-3-cyclohexyl-N-(1,3-thiazol-2-yl)propanamide (PubChem CID 25074308) has the molecular formula C22H25ClF2N4O4S2 and a molecular weight of 547.05 g/mol. Its IUPAC name is (2S)-2-[4-(4-chloro-2,5-difluorophenyl)sulfonyl-2-oxopiperazin-1-yl]-3-cyclohexyl-N-(1,3-thiazol-2-yl)propanamide.
| Compound Name | (2S)-2-[4-(4-chloro-2,5-difluorophenyl)sulfonyl-2-oxopiperazin-1-yl]-3-cyclohexyl-N-(1,3-thiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 25074308 |
| Molecular Formula | C22H25ClF2N4O4S2 |
| Molecular Weight | 547.05 g/mol |
| Exact Mass | 546.10 |
| IUPAC Name | (2S)-2-[4-(4-chloro-2,5-difluorophenyl)sulfonyl-2-oxopiperazin-1-yl]-3-cyclohexyl-N-(1,3-thiazol-2-yl)propanamide |
| SMILES | O=C(Nc1nccs1)[C@H](CC1CCCCC1)N1CCN(S(=O)(=O)c2cc(F)c(Cl)cc2F)CC1=O |
| InChI | InChI=1S/C22H25ClF2N4O4S2/c23-15-11-17(25)19(12-16(15)24)35(32,33)28-7-8-29(20(30)13-28)18(10-14-4-2-1-3-5-14)21(31)27-22-26-6-9-34-22/h6,9,11-12,14,18H,1-5,7-8,10,13H2,(H,26,27,31)/t18-/m0/s1 |
| InChIKey | RURHBVNSVRLMCV-SFHVURJKSA-N |
| XLogP | 3.89 |
| TPSA | 99.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.05 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|