C14H19BrO4 — CID 25075027
(1S,3R,4R,7S)-5-bromo-7-butoxy-1-(hydroxymethyl)spiro[bicyclo[2.2.2]oct-5-ene-3,2'-oxirane]-2-one (PubChem CID 25075027) has the molecular formula C14H19BrO4 and a molecular weight of 331.21 g/mol. Its IUPAC name is (1S,3R,4R,7S)-5-bromo-7-butoxy-1-(hydroxymethyl)spiro[bicyclo[2.2.2]oct-5-ene-3,2'-oxirane]-2-one.
| Compound Name | (1S,3R,4R,7S)-5-bromo-7-butoxy-1-(hydroxymethyl)spiro[bicyclo[2.2.2]oct-5-ene-3,2'-oxirane]-2-one |
|---|---|
| PubChem CID | 25075027 |
| Molecular Formula | C14H19BrO4 |
| Molecular Weight | 331.21 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | (1S,3R,4R,7S)-5-bromo-7-butoxy-1-(hydroxymethyl)spiro[bicyclo[2.2.2]oct-5-ene-3,2'-oxirane]-2-one |
| SMILES | CCCCO[C@H]1C[C@H]2C(Br)=C[C@@]1(CO)C(=O)[C@]21CO1 |
| InChI | InChI=1S/C14H19BrO4/c1-2-3-4-18-11-5-9-10(15)6-13(11,7-16)12(17)14(9)8-19-14/h6,9,11,16H,2-5,7-8H2,1H3/t9-,11-,13-,14-/m0/s1 |
| InChIKey | FTHQVPMQFZIPJT-RETIQXCHSA-N |
| XLogP | 1.80 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.21 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|