C28H44N4O6 — CID 25079010
(5R,6S,7S)-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-6-N-methyl-2-N-(2-morpholin-4-ylethyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 25079010) has the molecular formula C28H44N4O6 and a molecular weight of 532.68 g/mol. Its IUPAC name is (5R,6S,7S)-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-6-N-methyl-2-N-(2-morpholin-4-ylethyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7S)-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-6-N-methyl-2-N-(2-morpholin-4-ylethyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 25079010 |
| Molecular Formula | C28H44N4O6 |
| Molecular Weight | 532.68 g/mol |
| Exact Mass | 532.33 |
| IUPAC Name | (5R,6S,7S)-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-6-N-methyl-2-N-(2-morpholin-4-ylethyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(C)C(=O)[C@@H]1[C@@H]2CCC3(O2)C(C(=O)N(CC=C)CCN2CCOCC2)N([C@@H](CO)C(C)C)C(=O)[C@H]13 |
| InChI | InChI=1S/C28H44N4O6/c1-6-10-29(5)25(34)22-21-8-9-28(38-21)23(22)26(35)32(20(18-33)19(3)4)24(28)27(36)31(11-7-2)13-12-30-14-16-37-17-15-30/h6-7,19-24,33H,1-2,8-18H2,3-5H3/t20-,21-,22+,23-,24?,28?/m0/s1 |
| InChIKey | HPPNIBHZZSXJPB-HRMXGRDYSA-N |
| XLogP | 0.37 |
| TPSA | 102.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.68 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|