C24H31ClN4O2 — CID 25079265
[3-[[2-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]ethylamino]methyl]-6-chloroimidazo[1,2-a]pyridin-2-yl]-[(2S,6R)-2,6-dimethylmorpholin-4-yl]methanone (PubChem CID 25079265) has the molecular formula C24H31ClN4O2 and a molecular weight of 442.99 g/mol. Its IUPAC name is [3-[[2-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]ethylamino]methyl]-6-chloroimidazo[1,2-a]pyridin-2-yl]-[(2S,6R)-2,6-dimethylmorpholin-4-yl]methanone.
| Compound Name | [3-[[2-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]ethylamino]methyl]-6-chloroimidazo[1,2-a]pyridin-2-yl]-[(2S,6R)-2,6-dimethylmorpholin-4-yl]methanone |
|---|---|
| PubChem CID | 25079265 |
| Molecular Formula | C24H31ClN4O2 |
| Molecular Weight | 442.99 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | [3-[[2-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]ethylamino]methyl]-6-chloroimidazo[1,2-a]pyridin-2-yl]-[(2S,6R)-2,6-dimethylmorpholin-4-yl]methanone |
| SMILES | C[C@@H]1CN(C(=O)c2nc3ccc(Cl)cn3c2CNCC[C@@H]2C[C@@H]3C=C[C@H]2C3)C[C@H](C)O1 |
| InChI | InChI=1S/C24H31ClN4O2/c1-15-12-28(13-16(2)31-15)24(30)23-21(29-14-20(25)5-6-22(29)27-23)11-26-8-7-19-10-17-3-4-18(19)9-17/h3-6,14-19,26H,7-13H2,1-2H3/t15-,16+,17-,18+,19-/m1/s1 |
| InChIKey | JBUNRZLMPXYWAU-MTHXSQLBSA-N |
| XLogP | 3.93 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.99 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|