About (2-methyl-4-phenylpiperidin-4-yl) 3-methylbut-2-enoate;hydrochloride
(2-methyl-4-phenylpiperidin-4-yl) 3-methylbut-2-enoate;hydrochloride (PubChem CID 25079364) has the molecular formula C17H24ClNO2
and a molecular weight of 309.84 g/mol. Its IUPAC name is (2-methyl-4-phenylpiperidin-4-yl) 3-methylbut-2-enoate;hydrochloride.
Molecular Properties
| Compound Name | (2-methyl-4-phenylpiperidin-4-yl) 3-methylbut-2-enoate;hydrochloride |
| PubChem CID | 25079364 |
| Molecular Formula | C17H24ClNO2 |
| Molecular Weight | 309.84 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | (2-methyl-4-phenylpiperidin-4-yl) 3-methylbut-2-enoate;hydrochloride |
| SMILES | CC(C)=CC(=O)OC1(c2ccccc2)CCNC(C)C1.Cl |
| InChI | InChI=1S/C17H23NO2.ClH/c1-13(2)11-16(19)20-17(9-10-18-14(3)12-17)15-7-5-4-6-8-15;/h4-8,11,14,18H,9-10,12H2,1-3H3;1H |
| InChIKey | MMMSRVSQRPPNFP-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.84 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2-methyl-4-phenylpiperidin-4-yl) 3-methylbut-2-enoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methyl-4-phenylpiperidin-4-yl) 3-methylbut-2-enoate;hydrochloride?
The IUPAC name of (2-methyl-4-phenylpiperidin-4-yl) 3-methylbut-2-enoate;hydrochloride (CID 25079364) is (2-methyl-4-phenylpiperidin-4-yl) 3-methylbut-2-enoate;hydrochloride.
What is the SMILES notation for (2-methyl-4-phenylpiperidin-4-yl) 3-methylbut-2-enoate;hydrochloride?
The canonical SMILES for (2-methyl-4-phenylpiperidin-4-yl) 3-methylbut-2-enoate;hydrochloride is CC(C)=CC(=O)OC1(c2ccccc2)CCNC(C)C1.Cl.
What is the InChIKey of (2-methyl-4-phenylpiperidin-4-yl) 3-methylbut-2-enoate;hydrochloride?
The InChIKey is MMMSRVSQRPPNFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23NO2.ClH/c1-13(2)11-16(19)20-17(9-10-18-14(3)12-17)15-7-5-4-6-8-15;/h4-8,11,14,18H,9-10,12H2,1-3H3;1H.
What are the key properties of (2-methyl-4-phenylpiperidin-4-yl) 3-methylbut-2-enoate;hydrochloride?
(2-methyl-4-phenylpiperidin-4-yl) 3-methylbut-2-enoate;hydrochloride has a molecular weight of 309.84 g/mol, XLogP of 3.59, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methyl-4-phenylpiperidin-4-yl) 3-methylbut-2-enoate;hydrochloride is sourced from PubChem (CID 25079364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).