C14H24N2O5S3 — CID 25080129
6-(3-methoxypropyl)-7,7-dioxo-4-(propylamino)-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-sulfonamide (PubChem CID 25080129) has the molecular formula C14H24N2O5S3 and a molecular weight of 396.56 g/mol. Its IUPAC name is 6-(3-methoxypropyl)-7,7-dioxo-4-(propylamino)-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-sulfonamide.
| Compound Name | 6-(3-methoxypropyl)-7,7-dioxo-4-(propylamino)-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-sulfonamide |
|---|---|
| PubChem CID | 25080129 |
| Molecular Formula | C14H24N2O5S3 |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | 6-(3-methoxypropyl)-7,7-dioxo-4-(propylamino)-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-sulfonamide |
| SMILES | CCCNC1CC(CCCOC)S(=O)(=O)c2sc(S(N)(=O)=O)cc21 |
| InChI | InChI=1S/C14H24N2O5S3/c1-3-6-16-12-8-10(5-4-7-21-2)23(17,18)14-11(12)9-13(22-14)24(15,19)20/h9-10,12,16H,3-8H2,1-2H3,(H2,15,19,20) |
| InChIKey | JNPHBSXNRNBLCV-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|