C17H28O3 — CID 25082525
[(1R,3R,6S,7S,8S,10R)-3-hydroxy-2,2,6,8-tetramethyl-10-tricyclo[5.3.1.03,8]undecanyl] acetate (PubChem CID 25082525) has the molecular formula C17H28O3 and a molecular weight of 280.41 g/mol. Its IUPAC name is [(1R,3R,6S,7S,8S,10R)-3-hydroxy-2,2,6,8-tetramethyl-10-tricyclo[5.3.1.03,8]undecanyl] acetate.
| Compound Name | [(1R,3R,6S,7S,8S,10R)-3-hydroxy-2,2,6,8-tetramethyl-10-tricyclo[5.3.1.03,8]undecanyl] acetate |
|---|---|
| PubChem CID | 25082525 |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | [(1R,3R,6S,7S,8S,10R)-3-hydroxy-2,2,6,8-tetramethyl-10-tricyclo[5.3.1.03,8]undecanyl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@@]2(C)[C@H]3C[C@@H]1C(C)(C)[C@]2(O)CC[C@@H]3C |
| InChI | InChI=1S/C17H28O3/c1-10-6-7-17(19)15(3,4)13-8-12(10)16(17,5)9-14(13)20-11(2)18/h10,12-14,19H,6-9H2,1-5H3/t10-,12-,13-,14+,16-,17+/m0/s1 |
| InChIKey | RAPAFGOPSFDECW-UCDKGCPTSA-N |
| XLogP | 3.15 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |