C27H34N2O3 — CID 25083008
(1'R,2S,3aS,5'R)-3a-(3-methoxyphenyl)-5-(4-methoxyphenyl)-6',6'-dimethylspiro[4,6-dihydro-3H-imidazo[1,5-b][1,2]oxazole-2,2'-bicyclo[3.1.1]heptane] (PubChem CID 25083008) has the molecular formula C27H34N2O3 and a molecular weight of 434.58 g/mol. Its IUPAC name is (1'R,2S,3aS,5'R)-3a-(3-methoxyphenyl)-5-(4-methoxyphenyl)-6',6'-dimethylspiro[4,6-dihydro-3H-imidazo[1,5-b][1,2]oxazole-2,2'-bicyclo[3.1.1]heptane].
| Compound Name | (1'R,2S,3aS,5'R)-3a-(3-methoxyphenyl)-5-(4-methoxyphenyl)-6',6'-dimethylspiro[4,6-dihydro-3H-imidazo[1,5-b][1,2]oxazole-2,2'-bicyclo[3.1.1]heptane] |
|---|---|
| PubChem CID | 25083008 |
| Molecular Formula | C27H34N2O3 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.26 |
| IUPAC Name | (1'R,2S,3aS,5'R)-3a-(3-methoxyphenyl)-5-(4-methoxyphenyl)-6',6'-dimethylspiro[4,6-dihydro-3H-imidazo[1,5-b][1,2]oxazole-2,2'-bicyclo[3.1.1]heptane] |
| SMILES | COc1ccc(N2CN3O[C@@]4(CC[C@@H]5C[C@@H]4C5(C)C)C[C@]3(c3cccc(OC)c3)C2)cc1 |
| InChI | InChI=1S/C27H34N2O3/c1-25(2)19-12-13-27(24(25)15-19)16-26(20-6-5-7-23(14-20)31-4)17-28(18-29(26)32-27)21-8-10-22(30-3)11-9-21/h5-11,14,19,24H,12-13,15-18H2,1-4H3/t19-,24-,26-,27+/m1/s1 |
| InChIKey | PRSFVKZEBIMSHK-UZNTXHBPSA-N |
| XLogP | 5.21 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|