C24H37N3O4S — CID 25083471
(5S,6R,7S)-2-N-tert-butyl-3-(2-hydroxyethyl)-6-N,9-dimethyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 25083471) has the molecular formula C24H37N3O4S and a molecular weight of 463.64 g/mol. Its IUPAC name is (5S,6R,7S)-2-N-tert-butyl-3-(2-hydroxyethyl)-6-N,9-dimethyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6R,7S)-2-N-tert-butyl-3-(2-hydroxyethyl)-6-N,9-dimethyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 25083471 |
| Molecular Formula | C24H37N3O4S |
| Molecular Weight | 463.64 g/mol |
| Exact Mass | 463.25 |
| IUPAC Name | (5S,6R,7S)-2-N-tert-butyl-3-(2-hydroxyethyl)-6-N,9-dimethyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(C)C(=O)[C@@H]1[C@@H]2CC(C)C3(S2)C(C(=O)N(CC=C)C(C)(C)C)N(CCO)C(=O)[C@H]13 |
| InChI | InChI=1S/C24H37N3O4S/c1-8-10-25(7)20(29)17-16-14-15(3)24(32-16)18(17)21(30)26(12-13-28)19(24)22(31)27(11-9-2)23(4,5)6/h8-9,15-19,28H,1-2,10-14H2,3-7H3/t15?,16-,17+,18-,19?,24?/m0/s1 |
| InChIKey | WMARXZBTAKFEEG-NWKALXCASA-N |
| XLogP | 1.77 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.64 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|