About 2-(1,3-dioxoisoindol-2-yl)ethyl (E)-3-(4-nitrophenyl)prop-2-enoate
2-(1,3-dioxoisoindol-2-yl)ethyl (E)-3-(4-nitrophenyl)prop-2-enoate (PubChem CID 2508390) has the molecular formula C19H14N2O6
and a molecular weight of 366.33 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)ethyl (E)-3-(4-nitrophenyl)prop-2-enoate.
Molecular Properties
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)ethyl (E)-3-(4-nitrophenyl)prop-2-enoate |
| PubChem CID | 2508390 |
| Molecular Formula | C19H14N2O6 |
| Molecular Weight | 366.33 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)ethyl (E)-3-(4-nitrophenyl)prop-2-enoate |
| SMILES | O=C(/C=C/c1ccc([N+](=O)[O-])cc1)OCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H14N2O6/c22-17(10-7-13-5-8-14(9-6-13)21(25)26)27-12-11-20-18(23)15-3-1-2-4-16(15)19(20)24/h1-10H,11-12H2/b10-7+ |
| InChIKey | UJDNZWKBTRVIOU-JXMROGBWSA-N |
| XLogP | 2.45 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.33 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,3-dioxoisoindol-2-yl)ethyl (E)-3-(4-nitrophenyl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-dioxoisoindol-2-yl)ethyl (E)-3-(4-nitrophenyl)prop-2-enoate?
The IUPAC name of 2-(1,3-dioxoisoindol-2-yl)ethyl (E)-3-(4-nitrophenyl)prop-2-enoate (CID 2508390) is 2-(1,3-dioxoisoindol-2-yl)ethyl (E)-3-(4-nitrophenyl)prop-2-enoate.
What is the SMILES notation for 2-(1,3-dioxoisoindol-2-yl)ethyl (E)-3-(4-nitrophenyl)prop-2-enoate?
The canonical SMILES for 2-(1,3-dioxoisoindol-2-yl)ethyl (E)-3-(4-nitrophenyl)prop-2-enoate is O=C(/C=C/c1ccc([N+](=O)[O-])cc1)OCCN1C(=O)c2ccccc2C1=O.
What is the InChIKey of 2-(1,3-dioxoisoindol-2-yl)ethyl (E)-3-(4-nitrophenyl)prop-2-enoate?
The InChIKey is UJDNZWKBTRVIOU-JXMROGBWSA-N. The full InChI is InChI=1S/C19H14N2O6/c22-17(10-7-13-5-8-14(9-6-13)21(25)26)27-12-11-20-18(23)15-3-1-2-4-16(15)19(20)24/h1-10H,11-12H2/b10-7+.
What are the key properties of 2-(1,3-dioxoisoindol-2-yl)ethyl (E)-3-(4-nitrophenyl)prop-2-enoate?
2-(1,3-dioxoisoindol-2-yl)ethyl (E)-3-(4-nitrophenyl)prop-2-enoate has a molecular weight of 366.33 g/mol, XLogP of 2.45, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-dioxoisoindol-2-yl)ethyl (E)-3-(4-nitrophenyl)prop-2-enoate is sourced from PubChem (CID 2508390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).