C43H60O10 — CID 25085918
(2S,3S,4R,5R)-2-[(1S)-1-[(2R,3S,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]oxy-2-methoxyethyl]-3,4-dimethoxy-5-octoxyoxolane (PubChem CID 25085918) has the molecular formula C43H60O10 and a molecular weight of 736.94 g/mol. Its IUPAC name is (2S,3S,4R,5R)-2-[(1S)-1-[(2R,3S,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]oxy-2-methoxyethyl]-3,4-dimethoxy-5-octoxyoxolane.
| Compound Name | (2S,3S,4R,5R)-2-[(1S)-1-[(2R,3S,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]oxy-2-methoxyethyl]-3,4-dimethoxy-5-octoxyoxolane |
|---|---|
| PubChem CID | 25085918 |
| Molecular Formula | C43H60O10 |
| Molecular Weight | 736.94 g/mol |
| Exact Mass | 736.42 |
| IUPAC Name | (2S,3S,4R,5R)-2-[(1S)-1-[(2R,3S,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]oxy-2-methoxyethyl]-3,4-dimethoxy-5-octoxyoxolane |
| SMILES | CCCCCCCCO[C@@H]1O[C@@H]([C@H](COC)O[C@H]2O[C@H](COCc3ccccc3)[C@@H](OCc3ccccc3)[C@@H]2OCc2ccccc2)[C@H](OC)[C@H]1OC |
| InChI | InChI=1S/C43H60O10/c1-5-6-7-8-9-19-26-48-42-40(46-4)39(45-3)38(53-42)35(30-44-2)51-43-41(50-29-34-24-17-12-18-25-34)37(49-28-33-22-15-11-16-23-33)36(52-43)31-47-27-32-20-13-10-14-21-32/h10-18,20-25,35-43H,5-9,19,26-31H2,1-4H3/t35-,36+,37+,38-,39-,40+,41-,42+,43-/m0/s1 |
| InChIKey | JGLCIFYNSSMKRI-OLOGHWMOSA-N |
| XLogP | 7.26 |
| TPSA | 92.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.94 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|