About N-(2,5-dimethoxyphenyl)thieno[2,3-d]pyrimidin-4-amine
N-(2,5-dimethoxyphenyl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 2508929) has the molecular formula C14H13N3O2S
and a molecular weight of 287.34 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)thieno[2,3-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | N-(2,5-dimethoxyphenyl)thieno[2,3-d]pyrimidin-4-amine |
| PubChem CID | 2508929 |
| Molecular Formula | C14H13N3O2S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | COc1ccc(OC)c(Nc2ncnc3sccc23)c1 |
| InChI | InChI=1S/C14H13N3O2S/c1-18-9-3-4-12(19-2)11(7-9)17-13-10-5-6-20-14(10)16-8-15-13/h3-8H,1-2H3,(H,15,16,17) |
| InChIKey | JPKRTGHLTLDQFZ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(2,5-dimethoxyphenyl)thieno[2,3-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,5-dimethoxyphenyl)thieno[2,3-d]pyrimidin-4-amine?
The IUPAC name of N-(2,5-dimethoxyphenyl)thieno[2,3-d]pyrimidin-4-amine (CID 2508929) is N-(2,5-dimethoxyphenyl)thieno[2,3-d]pyrimidin-4-amine.
What is the SMILES notation for N-(2,5-dimethoxyphenyl)thieno[2,3-d]pyrimidin-4-amine?
The canonical SMILES for N-(2,5-dimethoxyphenyl)thieno[2,3-d]pyrimidin-4-amine is COc1ccc(OC)c(Nc2ncnc3sccc23)c1.
What is the InChIKey of N-(2,5-dimethoxyphenyl)thieno[2,3-d]pyrimidin-4-amine?
The InChIKey is JPKRTGHLTLDQFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N3O2S/c1-18-9-3-4-12(19-2)11(7-9)17-13-10-5-6-20-14(10)16-8-15-13/h3-8H,1-2H3,(H,15,16,17).
What are the key properties of N-(2,5-dimethoxyphenyl)thieno[2,3-d]pyrimidin-4-amine?
N-(2,5-dimethoxyphenyl)thieno[2,3-d]pyrimidin-4-amine has a molecular weight of 287.34 g/mol, XLogP of 3.45, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,5-dimethoxyphenyl)thieno[2,3-d]pyrimidin-4-amine is sourced from PubChem (CID 2508929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).