C24H27N3O5S — CID 2508993
methyl (2R)-3-(1H-indol-3-yl)-2-[(3-piperidin-1-ylsulfonylbenzoyl)amino]propanoate (PubChem CID 2508993) has the molecular formula C24H27N3O5S and a molecular weight of 469.56 g/mol. Its IUPAC name is methyl (2R)-3-(1H-indol-3-yl)-2-[(3-piperidin-1-ylsulfonylbenzoyl)amino]propanoate.
| Compound Name | methyl (2R)-3-(1H-indol-3-yl)-2-[(3-piperidin-1-ylsulfonylbenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 2508993 |
| Molecular Formula | C24H27N3O5S |
| Molecular Weight | 469.56 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | methyl (2R)-3-(1H-indol-3-yl)-2-[(3-piperidin-1-ylsulfonylbenzoyl)amino]propanoate |
| SMILES | COC(=O)[C@@H](Cc1c[nH]c2ccccc12)NC(=O)c1cccc(S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C24H27N3O5S/c1-32-24(29)22(15-18-16-25-21-11-4-3-10-20(18)21)26-23(28)17-8-7-9-19(14-17)33(30,31)27-12-5-2-6-13-27/h3-4,7-11,14,16,22,25H,2,5-6,12-13,15H2,1H3,(H,26,28)/t22-/m1/s1 |
| InChIKey | NJZLKNMZNXPAHG-JOCHJYFZSA-N |
| XLogP | 2.86 |
| TPSA | 108.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.56 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |