C18H38O4Si2 — CID 25090375
[(1S,7S,8R)-3,3,5,5-tetra(propan-2-yl)-2,4,6-trioxa-3,5-disilabicyclo[5.2.1]decan-8-yl]methanol (PubChem CID 25090375) has the molecular formula C18H38O4Si2 and a molecular weight of 374.67 g/mol. Its IUPAC name is [(1S,7S,8R)-3,3,5,5-tetra(propan-2-yl)-2,4,6-trioxa-3,5-disilabicyclo[5.2.1]decan-8-yl]methanol.
| Compound Name | [(1S,7S,8R)-3,3,5,5-tetra(propan-2-yl)-2,4,6-trioxa-3,5-disilabicyclo[5.2.1]decan-8-yl]methanol |
|---|---|
| PubChem CID | 25090375 |
| Molecular Formula | C18H38O4Si2 |
| Molecular Weight | 374.67 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | [(1S,7S,8R)-3,3,5,5-tetra(propan-2-yl)-2,4,6-trioxa-3,5-disilabicyclo[5.2.1]decan-8-yl]methanol |
| SMILES | CC(C)[Si]1(C(C)C)O[C@H]2C[C@H](CO)[C@H](C2)O[Si](C(C)C)(C(C)C)O1 |
| InChI | InChI=1S/C18H38O4Si2/c1-12(2)23(13(3)4)20-17-9-16(11-19)18(10-17)21-24(22-23,14(5)6)15(7)8/h12-19H,9-11H2,1-8H3/t16-,17+,18+/m1/s1 |
| InChIKey | OVYWNTQNAHZWKG-SQNIBIBYSA-N |
| XLogP | 4.71 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.67 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|