C14H23ClN6 — CID 25090617
4-[(1,4-dimethyl-1,5-dihydro-1,2,4-triazol-1-ium-5-yl)diazenyl]-N,N-diethylaniline chloride (PubChem CID 25090617) has the molecular formula C14H23ClN6 and a molecular weight of 310.83 g/mol. Its IUPAC name is 4-[(1,4-dimethyl-1,5-dihydro-1,2,4-triazol-1-ium-5-yl)diazenyl]-N,N-diethylaniline chloride.
| Compound Name | 4-[(1,4-dimethyl-1,5-dihydro-1,2,4-triazol-1-ium-5-yl)diazenyl]-N,N-diethylaniline chloride |
|---|---|
| PubChem CID | 25090617 |
| Molecular Formula | C14H23ClN6 |
| Molecular Weight | 310.83 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 4-[(1,4-dimethyl-1,5-dihydro-1,2,4-triazol-1-ium-5-yl)diazenyl]-N,N-diethylaniline chloride |
| SMILES | CCN(CC)c1ccc(/N=N/C2N(C)C=N[NH+]2C)cc1.[Cl-] |
| InChI | InChI=1S/C14H22N6.ClH/c1-5-20(6-2)13-9-7-12(8-10-13)16-17-14-18(3)11-15-19(14)4;/h7-11,14H,5-6H2,1-4H3;1H/b17-16+; |
| InChIKey | SACUGCOXIBNKOU-CMBBICFISA-N |
| XLogP | -1.69 |
| TPSA | 48.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.83 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|