C15H21IO4 — CID 25090702
(1S,3R,4R,7S)-7-(6-hydroxyhexoxy)-5-iodospiro[bicyclo[2.2.2]oct-5-ene-3,2'-oxirane]-2-one (PubChem CID 25090702) has the molecular formula C15H21IO4 and a molecular weight of 392.23 g/mol. Its IUPAC name is (1S,3R,4R,7S)-7-(6-hydroxyhexoxy)-5-iodospiro[bicyclo[2.2.2]oct-5-ene-3,2'-oxirane]-2-one.
| Compound Name | (1S,3R,4R,7S)-7-(6-hydroxyhexoxy)-5-iodospiro[bicyclo[2.2.2]oct-5-ene-3,2'-oxirane]-2-one |
|---|---|
| PubChem CID | 25090702 |
| Molecular Formula | C15H21IO4 |
| Molecular Weight | 392.23 g/mol |
| Exact Mass | 392.05 |
| IUPAC Name | (1S,3R,4R,7S)-7-(6-hydroxyhexoxy)-5-iodospiro[bicyclo[2.2.2]oct-5-ene-3,2'-oxirane]-2-one |
| SMILES | O=C1[C@H]2C=C(I)[C@H](C[C@@H]2OCCCCCCO)[C@@]12CO2 |
| InChI | InChI=1S/C15H21IO4/c16-12-7-10-13(19-6-4-2-1-3-5-17)8-11(12)15(9-20-15)14(10)18/h7,10-11,13,17H,1-6,8-9H2/t10-,11-,13-,15-/m0/s1 |
| InChIKey | QFMSBBZGQQICDX-UHXUCMFUSA-N |
| XLogP | 2.23 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.23 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|