About 2,4-diethyl-10,10-dioxothioxanthen-9-one
2,4-diethyl-10,10-dioxothioxanthen-9-one (PubChem CID 25090832) has the molecular formula C17H16O3S
and a molecular weight of 300.38 g/mol. Its IUPAC name is 2,4-diethyl-10,10-dioxothioxanthen-9-one.
Molecular Properties
| Compound Name | 2,4-diethyl-10,10-dioxothioxanthen-9-one |
| PubChem CID | 25090832 |
| Molecular Formula | C17H16O3S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 2,4-diethyl-10,10-dioxothioxanthen-9-one |
| SMILES | CCc1cc(CC)c2c(c1)C(=O)c1ccccc1S2(=O)=O |
| InChI | InChI=1S/C17H16O3S/c1-3-11-9-12(4-2)17-14(10-11)16(18)13-7-5-6-8-15(13)21(17,19)20/h5-10H,3-4H2,1-2H3 |
| InChIKey | NKVRNMCFIYCIQS-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,4-diethyl-10,10-dioxothioxanthen-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-diethyl-10,10-dioxothioxanthen-9-one?
The IUPAC name of 2,4-diethyl-10,10-dioxothioxanthen-9-one (CID 25090832) is 2,4-diethyl-10,10-dioxothioxanthen-9-one.
What is the SMILES notation for 2,4-diethyl-10,10-dioxothioxanthen-9-one?
The canonical SMILES for 2,4-diethyl-10,10-dioxothioxanthen-9-one is CCc1cc(CC)c2c(c1)C(=O)c1ccccc1S2(=O)=O.
What is the InChIKey of 2,4-diethyl-10,10-dioxothioxanthen-9-one?
The InChIKey is NKVRNMCFIYCIQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16O3S/c1-3-11-9-12(4-2)17-14(10-11)16(18)13-7-5-6-8-15(13)21(17,19)20/h5-10H,3-4H2,1-2H3.
What are the key properties of 2,4-diethyl-10,10-dioxothioxanthen-9-one?
2,4-diethyl-10,10-dioxothioxanthen-9-one has a molecular weight of 300.38 g/mol, XLogP of 3.19, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-diethyl-10,10-dioxothioxanthen-9-one is sourced from PubChem (CID 25090832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).