C26H40N2O5S — CID 25091163
prop-2-enyl (5S,6S,7R)-3-(4-hydroxybutyl)-9-methyl-4-oxo-2-[pentyl(prop-2-enyl)carbamoyl]-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 25091163) has the molecular formula C26H40N2O5S and a molecular weight of 492.68 g/mol. Its IUPAC name is prop-2-enyl (5S,6S,7R)-3-(4-hydroxybutyl)-9-methyl-4-oxo-2-[pentyl(prop-2-enyl)carbamoyl]-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | prop-2-enyl (5S,6S,7R)-3-(4-hydroxybutyl)-9-methyl-4-oxo-2-[pentyl(prop-2-enyl)carbamoyl]-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 25091163 |
| Molecular Formula | C26H40N2O5S |
| Molecular Weight | 492.68 g/mol |
| Exact Mass | 492.27 |
| IUPAC Name | prop-2-enyl (5S,6S,7R)-3-(4-hydroxybutyl)-9-methyl-4-oxo-2-[pentyl(prop-2-enyl)carbamoyl]-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCOC(=O)[C@@H]1[C@H]2C(=O)N(CCCCO)C(C(=O)N(CC=C)CCCCC)C23S[C@@H]1CC3C |
| InChI | InChI=1S/C26H40N2O5S/c1-5-8-9-13-27(12-6-2)24(31)22-26-18(4)17-19(34-26)20(25(32)33-16-7-3)21(26)23(30)28(22)14-10-11-15-29/h6-7,18-22,29H,2-3,5,8-17H2,1,4H3/t18?,19-,20+,21+,22?,26?/m1/s1 |
| InChIKey | ZPYPUIAJIPRVGM-ZJHJXGQNSA-N |
| XLogP | 3.03 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.68 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|