C31H47N3O7 — CID 25093020
[(2R)-1-(pent-4-enoylamino)propan-2-yl] (1S,2S,5R,6R,7R)-2-[cyclohexyl(prop-2-enyl)carbamoyl]-3-[(2S)-1-hydroxybutan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 25093020) has the molecular formula C31H47N3O7 and a molecular weight of 573.73 g/mol. Its IUPAC name is [(2R)-1-(pent-4-enoylamino)propan-2-yl] (1S,2S,5R,6R,7R)-2-[cyclohexyl(prop-2-enyl)carbamoyl]-3-[(2S)-1-hydroxybutan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | [(2R)-1-(pent-4-enoylamino)propan-2-yl] (1S,2S,5R,6R,7R)-2-[cyclohexyl(prop-2-enyl)carbamoyl]-3-[(2S)-1-hydroxybutan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 25093020 |
| Molecular Formula | C31H47N3O7 |
| Molecular Weight | 573.73 g/mol |
| Exact Mass | 573.34 |
| IUPAC Name | [(2R)-1-(pent-4-enoylamino)propan-2-yl] (1S,2S,5R,6R,7R)-2-[cyclohexyl(prop-2-enyl)carbamoyl]-3-[(2S)-1-hydroxybutan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCCC(=O)NC[C@@H](C)OC(=O)[C@@H]1[C@H]2C(=O)N([C@@H](CC)CO)[C@H](C(=O)N(CC=C)C3CCCCC3)[C@]23CC[C@H]1O3 |
| InChI | InChI=1S/C31H47N3O7/c1-5-8-14-24(36)32-18-20(4)40-30(39)25-23-15-16-31(41-23)26(25)28(37)34(21(7-3)19-35)27(31)29(38)33(17-6-2)22-12-10-9-11-13-22/h5-6,20-23,25-27,35H,1-2,7-19H2,3-4H3,(H,32,36)/t20-,21+,23-,25+,26+,27-,31+/m1/s1 |
| InChIKey | QONYWBJDROODPN-ZJJGFAQYSA-N |
| XLogP | 2.49 |
| TPSA | 125.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.73 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|