C9H10O4 — CID 25093120
(1S,3R,6S,8R)-6,8-dimethyl-2,7-dioxatricyclo[4.2.1.03,8]nonane-4,9-dione (PubChem CID 25093120) has the molecular formula C9H10O4 and a molecular weight of 182.17 g/mol. Its IUPAC name is (1S,3R,6S,8R)-6,8-dimethyl-2,7-dioxatricyclo[4.2.1.03,8]nonane-4,9-dione.
| Compound Name | (1S,3R,6S,8R)-6,8-dimethyl-2,7-dioxatricyclo[4.2.1.03,8]nonane-4,9-dione |
|---|---|
| PubChem CID | 25093120 |
| Molecular Formula | C9H10O4 |
| Molecular Weight | 182.17 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | (1S,3R,6S,8R)-6,8-dimethyl-2,7-dioxatricyclo[4.2.1.03,8]nonane-4,9-dione |
| SMILES | C[C@@]12O[C@@]3(C)CC(=O)[C@@H]1O[C@@H]2C3=O |
| InChI | InChI=1S/C9H10O4/c1-8-3-4(10)6-9(2,13-8)7(12-6)5(8)11/h6-7H,3H2,1-2H3/t6-,7+,8-,9+/m0/s1 |
| InChIKey | JXKXKYMAVNWECK-UYXSQOIJSA-N |
| XLogP | -0.16 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.17 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |