About 1-(3,5-dichlorophenyl)-3-methyl-N-[(1S)-1-phenylethyl]pyrazolo[4,3-c]pyridin-6-amine
1-(3,5-dichlorophenyl)-3-methyl-N-[(1S)-1-phenylethyl]pyrazolo[4,3-c]pyridin-6-amine (PubChem CID 25093258) has the molecular formula C21H18Cl2N4
and a molecular weight of 397.31 g/mol. Its IUPAC name is 1-(3,5-dichlorophenyl)-3-methyl-N-[(1S)-1-phenylethyl]pyrazolo[4,3-c]pyridin-6-amine.
Molecular Properties
| Compound Name | 1-(3,5-dichlorophenyl)-3-methyl-N-[(1S)-1-phenylethyl]pyrazolo[4,3-c]pyridin-6-amine |
| PubChem CID | 25093258 |
| Molecular Formula | C21H18Cl2N4 |
| Molecular Weight | 397.31 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | 1-(3,5-dichlorophenyl)-3-methyl-N-[(1S)-1-phenylethyl]pyrazolo[4,3-c]pyridin-6-amine |
| SMILES | Cc1nn(-c2cc(Cl)cc(Cl)c2)c2cc(N[C@@H](C)c3ccccc3)ncc12 |
| InChI | InChI=1S/C21H18Cl2N4/c1-13(15-6-4-3-5-7-15)25-21-11-20-19(12-24-21)14(2)26-27(20)18-9-16(22)8-17(23)10-18/h3-13H,1-2H3,(H,24,25)/t13-/m0/s1 |
| InChIKey | ZPZIHCYPRUTMCK-ZDUSSCGKSA-N |
| XLogP | 6.21 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 397.31 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(3,5-dichlorophenyl)-3-methyl-N-[(1S)-1-phenylethyl]pyrazolo[4,3-c]pyridin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,5-dichlorophenyl)-3-methyl-N-[(1S)-1-phenylethyl]pyrazolo[4,3-c]pyridin-6-amine?
The IUPAC name of 1-(3,5-dichlorophenyl)-3-methyl-N-[(1S)-1-phenylethyl]pyrazolo[4,3-c]pyridin-6-amine (CID 25093258) is 1-(3,5-dichlorophenyl)-3-methyl-N-[(1S)-1-phenylethyl]pyrazolo[4,3-c]pyridin-6-amine.
What is the SMILES notation for 1-(3,5-dichlorophenyl)-3-methyl-N-[(1S)-1-phenylethyl]pyrazolo[4,3-c]pyridin-6-amine?
The canonical SMILES for 1-(3,5-dichlorophenyl)-3-methyl-N-[(1S)-1-phenylethyl]pyrazolo[4,3-c]pyridin-6-amine is Cc1nn(-c2cc(Cl)cc(Cl)c2)c2cc(N[C@@H](C)c3ccccc3)ncc12.
What is the InChIKey of 1-(3,5-dichlorophenyl)-3-methyl-N-[(1S)-1-phenylethyl]pyrazolo[4,3-c]pyridin-6-amine?
The InChIKey is ZPZIHCYPRUTMCK-ZDUSSCGKSA-N. The full InChI is InChI=1S/C21H18Cl2N4/c1-13(15-6-4-3-5-7-15)25-21-11-20-19(12-24-21)14(2)26-27(20)18-9-16(22)8-17(23)10-18/h3-13H,1-2H3,(H,24,25)/t13-/m0/s1.
What are the key properties of 1-(3,5-dichlorophenyl)-3-methyl-N-[(1S)-1-phenylethyl]pyrazolo[4,3-c]pyridin-6-amine?
1-(3,5-dichlorophenyl)-3-methyl-N-[(1S)-1-phenylethyl]pyrazolo[4,3-c]pyridin-6-amine has a molecular weight of 397.31 g/mol, XLogP of 6.21, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,5-dichlorophenyl)-3-methyl-N-[(1S)-1-phenylethyl]pyrazolo[4,3-c]pyridin-6-amine is sourced from PubChem (CID 25093258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).