C17H21NO3 — CID 2509328
[2-(cyclohexylamino)-2-oxoethyl] (E)-3-phenylprop-2-enoate (PubChem CID 2509328) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is [2-(cyclohexylamino)-2-oxoethyl] (E)-3-phenylprop-2-enoate.
| Compound Name | [2-(cyclohexylamino)-2-oxoethyl] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 2509328 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | [2-(cyclohexylamino)-2-oxoethyl] (E)-3-phenylprop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1ccccc1)NC1CCCCC1 |
| InChI | InChI=1S/C17H21NO3/c19-16(18-15-9-5-2-6-10-15)13-21-17(20)12-11-14-7-3-1-4-8-14/h1,3-4,7-8,11-12,15H,2,5-6,9-10,13H2,(H,18,19)/b12-11+ |
| InChIKey | ZSVFUKTZFXDVHA-VAWYXSNFSA-N |
| XLogP | 2.69 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|