C25H26N4O2 — CID 25093402
2-[3-(2-methyl-4-quinolin-2-ylpiperazin-1-yl)propyl]isoindole-1,3-dione (PubChem CID 25093402) has the molecular formula C25H26N4O2 and a molecular weight of 414.51 g/mol. Its IUPAC name is 2-[3-(2-methyl-4-quinolin-2-ylpiperazin-1-yl)propyl]isoindole-1,3-dione.
| Compound Name | 2-[3-(2-methyl-4-quinolin-2-ylpiperazin-1-yl)propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 25093402 |
| Molecular Formula | C25H26N4O2 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | 2-[3-(2-methyl-4-quinolin-2-ylpiperazin-1-yl)propyl]isoindole-1,3-dione |
| SMILES | CC1CN(c2ccc3ccccc3n2)CCN1CCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C25H26N4O2/c1-18-17-28(23-12-11-19-7-2-5-10-22(19)26-23)16-15-27(18)13-6-14-29-24(30)20-8-3-4-9-21(20)25(29)31/h2-5,7-12,18H,6,13-17H2,1H3 |
| InChIKey | SDGHUAVDABDNPR-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|