C15H9F5N4O3S — CID 25093426
2-(hydrazinecarbonyl)-3-(2,3,4,5,6-pentafluorophenyl)-1H-indole-5-sulfonamide (PubChem CID 25093426) has the molecular formula C15H9F5N4O3S and a molecular weight of 420.32 g/mol. Its IUPAC name is 2-(hydrazinecarbonyl)-3-(2,3,4,5,6-pentafluorophenyl)-1H-indole-5-sulfonamide.
| Compound Name | 2-(hydrazinecarbonyl)-3-(2,3,4,5,6-pentafluorophenyl)-1H-indole-5-sulfonamide |
|---|---|
| PubChem CID | 25093426 |
| Molecular Formula | C15H9F5N4O3S |
| Molecular Weight | 420.32 g/mol |
| Exact Mass | 420.03 |
| IUPAC Name | 2-(hydrazinecarbonyl)-3-(2,3,4,5,6-pentafluorophenyl)-1H-indole-5-sulfonamide |
| SMILES | NNC(=O)c1[nH]c2ccc(S(N)(=O)=O)cc2c1-c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C15H9F5N4O3S/c16-9-8(10(17)12(19)13(20)11(9)18)7-5-3-4(28(22,26)27)1-2-6(5)23-14(7)15(25)24-21/h1-3,23H,21H2,(H,24,25)(H2,22,26,27) |
| InChIKey | AWDKBDAWOHYQRV-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 131.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.32 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|