C15H15N5OS — CID 25093428
N'-[4-(furan-3-yl)-12-methyl-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-8-yl]ethane-1,2-diamine (PubChem CID 25093428) has the molecular formula C15H15N5OS and a molecular weight of 313.39 g/mol. Its IUPAC name is N'-[4-(furan-3-yl)-12-methyl-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-8-yl]ethane-1,2-diamine.
| Compound Name | N'-[4-(furan-3-yl)-12-methyl-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-8-yl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 25093428 |
| Molecular Formula | C15H15N5OS |
| Molecular Weight | 313.39 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | N'-[4-(furan-3-yl)-12-methyl-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-8-yl]ethane-1,2-diamine |
| SMILES | Cc1cnc2c(NCCN)nc3cc(-c4ccoc4)sc3n12 |
| InChI | InChI=1S/C15H15N5OS/c1-9-7-18-14-13(17-4-3-16)19-11-6-12(10-2-5-21-8-10)22-15(11)20(9)14/h2,5-8H,3-4,16H2,1H3,(H,17,19) |
| InChIKey | VKGBHSPPHIPQGF-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 81.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.39 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |