C18H19N5OS — CID 25093437
N'-[4-(4-methoxyphenyl)-12-methyl-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-8-yl]ethane-1,2-diamine (PubChem CID 25093437) has the molecular formula C18H19N5OS and a molecular weight of 353.45 g/mol. Its IUPAC name is N'-[4-(4-methoxyphenyl)-12-methyl-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-8-yl]ethane-1,2-diamine.
| Compound Name | N'-[4-(4-methoxyphenyl)-12-methyl-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-8-yl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 25093437 |
| Molecular Formula | C18H19N5OS |
| Molecular Weight | 353.45 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | N'-[4-(4-methoxyphenyl)-12-methyl-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-8-yl]ethane-1,2-diamine |
| SMILES | COc1ccc(-c2cc3nc(NCCN)c4ncc(C)n4c3s2)cc1 |
| InChI | InChI=1S/C18H19N5OS/c1-11-10-21-17-16(20-8-7-19)22-14-9-15(25-18(14)23(11)17)12-3-5-13(24-2)6-4-12/h3-6,9-10H,7-8,19H2,1-2H3,(H,20,22) |
| InChIKey | HSNDPVGLJSNMLF-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 77.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.45 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |