C18H19N5OS — CID 25093438
[2-[8-(2-aminoethylamino)-12-methyl-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-4-yl]phenyl]methanol (PubChem CID 25093438) has the molecular formula C18H19N5OS and a molecular weight of 353.45 g/mol. Its IUPAC name is [2-[8-(2-aminoethylamino)-12-methyl-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-4-yl]phenyl]methanol.
| Compound Name | [2-[8-(2-aminoethylamino)-12-methyl-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-4-yl]phenyl]methanol |
|---|---|
| PubChem CID | 25093438 |
| Molecular Formula | C18H19N5OS |
| Molecular Weight | 353.45 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | [2-[8-(2-aminoethylamino)-12-methyl-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-4-yl]phenyl]methanol |
| SMILES | Cc1cnc2c(NCCN)nc3cc(-c4ccccc4CO)sc3n12 |
| InChI | InChI=1S/C18H19N5OS/c1-11-9-21-17-16(20-7-6-19)22-14-8-15(25-18(14)23(11)17)13-5-3-2-4-12(13)10-24/h2-5,8-9,24H,6-7,10,19H2,1H3,(H,20,22) |
| InChIKey | XGFBARHKTYXMCA-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 88.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.45 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |