C18H18N6OS — CID 25093445
[3-[12-methyl-8-(methylamino)-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-4-yl]phenyl]methylurea (PubChem CID 25093445) has the molecular formula C18H18N6OS and a molecular weight of 366.45 g/mol. Its IUPAC name is [3-[12-methyl-8-(methylamino)-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-4-yl]phenyl]methylurea.
| Compound Name | [3-[12-methyl-8-(methylamino)-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-4-yl]phenyl]methylurea |
|---|---|
| PubChem CID | 25093445 |
| Molecular Formula | C18H18N6OS |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | [3-[12-methyl-8-(methylamino)-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-4-yl]phenyl]methylurea |
| SMILES | CNc1nc2cc(-c3cccc(CNC(N)=O)c3)sc2n2c(C)cnc12 |
| InChI | InChI=1S/C18H18N6OS/c1-10-8-21-16-15(20-2)23-13-7-14(26-17(13)24(10)16)12-5-3-4-11(6-12)9-22-18(19)25/h3-8H,9H2,1-2H3,(H,20,23)(H3,19,22,25) |
| InChIKey | MCGRFOSDZZVTTO-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 97.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |