C18H20N6O2S2 — CID 25093451
12-methyl-8-(methylamino)-4-[3-[2-(sulfamoylamino)ethyl]phenyl]-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene (PubChem CID 25093451) has the molecular formula C18H20N6O2S2 and a molecular weight of 416.53 g/mol. Its IUPAC name is 12-methyl-8-(methylamino)-4-[3-[2-(sulfamoylamino)ethyl]phenyl]-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene.
| Compound Name | 12-methyl-8-(methylamino)-4-[3-[2-(sulfamoylamino)ethyl]phenyl]-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene |
|---|---|
| PubChem CID | 25093451 |
| Molecular Formula | C18H20N6O2S2 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | 12-methyl-8-(methylamino)-4-[3-[2-(sulfamoylamino)ethyl]phenyl]-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene |
| SMILES | CNc1nc2cc(-c3cccc(CCNS(N)(=O)=O)c3)sc2n2c(C)cnc12 |
| InChI | InChI=1S/C18H20N6O2S2/c1-11-10-21-17-16(20-2)23-14-9-15(27-18(14)24(11)17)13-5-3-4-12(8-13)6-7-22-28(19,25)26/h3-5,8-10,22H,6-7H2,1-2H3,(H,20,23)(H2,19,25,26) |
| InChIKey | WESZAXMBDDQWNG-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 114.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |