C21H24N6OS — CID 25093452
N-methyl-2-[2-[3-[12-methyl-8-(methylamino)-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-4-yl]phenyl]ethylamino]acetamide (PubChem CID 25093452) has the molecular formula C21H24N6OS and a molecular weight of 408.53 g/mol. Its IUPAC name is N-methyl-2-[2-[3-[12-methyl-8-(methylamino)-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-4-yl]phenyl]ethylamino]acetamide.
| Compound Name | N-methyl-2-[2-[3-[12-methyl-8-(methylamino)-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-4-yl]phenyl]ethylamino]acetamide |
|---|---|
| PubChem CID | 25093452 |
| Molecular Formula | C21H24N6OS |
| Molecular Weight | 408.53 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | N-methyl-2-[2-[3-[12-methyl-8-(methylamino)-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-4-yl]phenyl]ethylamino]acetamide |
| SMILES | CNC(=O)CNCCc1cccc(-c2cc3nc(NC)c4ncc(C)n4c3s2)c1 |
| InChI | InChI=1S/C21H24N6OS/c1-13-11-25-20-19(23-3)26-16-10-17(29-21(16)27(13)20)15-6-4-5-14(9-15)7-8-24-12-18(28)22-2/h4-6,9-11,24H,7-8,12H2,1-3H3,(H,22,28)(H,23,26) |
| InChIKey | FLGGTJDUMUNBCT-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 83.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.53 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|