C28H32N4O4 — CID 25094077
2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-4-(3,6,6-trimethyl-4-oxo-5,7-dihydroindazol-1-yl)benzamide (PubChem CID 25094077) has the molecular formula C28H32N4O4 and a molecular weight of 488.59 g/mol. Its IUPAC name is 2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-4-(3,6,6-trimethyl-4-oxo-5,7-dihydroindazol-1-yl)benzamide.
| Compound Name | 2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-4-(3,6,6-trimethyl-4-oxo-5,7-dihydroindazol-1-yl)benzamide |
|---|---|
| PubChem CID | 25094077 |
| Molecular Formula | C28H32N4O4 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.24 |
| IUPAC Name | 2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-4-(3,6,6-trimethyl-4-oxo-5,7-dihydroindazol-1-yl)benzamide |
| SMILES | COc1cc2c(cc1OC)CN(c1cc(-n3nc(C)c4c3CC(C)(C)CC4=O)ccc1C(N)=O)CC2 |
| InChI | InChI=1S/C28H32N4O4/c1-16-26-22(13-28(2,3)14-23(26)33)32(30-16)19-6-7-20(27(29)34)21(12-19)31-9-8-17-10-24(35-4)25(36-5)11-18(17)15-31/h6-7,10-12H,8-9,13-15H2,1-5H3,(H2,29,34) |
| InChIKey | DGDWELDRXNYFHM-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 99.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |