C33H45N3O10 — CID 25094095
2-(2-nitrooxyethoxy)ethyl (3R)-4-(1,3-benzodioxol-5-yl)-1-[2-(dibutylamino)-2-oxoethyl]-2-(4-methoxyphenyl)pyrrolidine-3-carboxylate (PubChem CID 25094095) has the molecular formula C33H45N3O10 and a molecular weight of 643.73 g/mol. Its IUPAC name is 2-(2-nitrooxyethoxy)ethyl (3R)-4-(1,3-benzodioxol-5-yl)-1-[2-(dibutylamino)-2-oxoethyl]-2-(4-methoxyphenyl)pyrrolidine-3-carboxylate.
| Compound Name | 2-(2-nitrooxyethoxy)ethyl (3R)-4-(1,3-benzodioxol-5-yl)-1-[2-(dibutylamino)-2-oxoethyl]-2-(4-methoxyphenyl)pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 25094095 |
| Molecular Formula | C33H45N3O10 |
| Molecular Weight | 643.73 g/mol |
| Exact Mass | 643.31 |
| IUPAC Name | 2-(2-nitrooxyethoxy)ethyl (3R)-4-(1,3-benzodioxol-5-yl)-1-[2-(dibutylamino)-2-oxoethyl]-2-(4-methoxyphenyl)pyrrolidine-3-carboxylate |
| SMILES | CCCCN(CCCC)C(=O)CN1CC(c2ccc3c(c2)OCO3)[C@@H](C(=O)OCCOCCO[N+](=O)[O-])C1c1ccc(OC)cc1 |
| InChI | InChI=1S/C33H45N3O10/c1-4-6-14-34(15-7-5-2)30(37)22-35-21-27(25-10-13-28-29(20-25)45-23-44-28)31(32(35)24-8-11-26(41-3)12-9-24)33(38)43-18-16-42-17-19-46-36(39)40/h8-13,20,27,31-32H,4-7,14-19,21-23H2,1-3H3/t27?,31-,32?/m1/s1 |
| InChIKey | LMRSLSLTRZCDCJ-XPMOPWTBSA-N |
| XLogP | 4.38 |
| TPSA | 139.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.73 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|