C23H27NO6 — CID 25094226
(2S)-2-hydroxybutanedioic acid;(2E,9R)-2-[3-(methylamino)propylidene]tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaen-9-ol (PubChem CID 25094226) has the molecular formula C23H27NO6 and a molecular weight of 413.47 g/mol. Its IUPAC name is (2S)-2-hydroxybutanedioic acid;(2E,9R)-2-[3-(methylamino)propylidene]tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaen-9-ol.
| Compound Name | (2S)-2-hydroxybutanedioic acid;(2E,9R)-2-[3-(methylamino)propylidene]tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaen-9-ol |
|---|---|
| PubChem CID | 25094226 |
| Molecular Formula | C23H27NO6 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | (2S)-2-hydroxybutanedioic acid;(2E,9R)-2-[3-(methylamino)propylidene]tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaen-9-ol |
| SMILES | CNCC/C=C1\c2ccccc2C[C@@H](O)c2ccccc21.O=C(O)C[C@H](O)C(=O)O |
| InChI | InChI=1S/C19H21NO.C4H6O5/c1-20-12-6-11-16-15-8-3-2-7-14(15)13-19(21)18-10-5-4-9-17(16)18;5-2(4(8)9)1-3(6)7/h2-5,7-11,19-21H,6,12-13H2,1H3;2,5H,1H2,(H,6,7)(H,8,9)/b16-11+;/t19-;2-/m10/s1 |
| InChIKey | ZMVMUCDJNCSEIH-IKNNCMSNSA-N |
| XLogP | 2.22 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'styrene_A(13)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|