C24H26N4O4 — CID 25094492
2-[7-(2-methoxyethoxy)imidazo[1,2-a]pyridin-3-yl]-8-[(3R,4R)-4-methoxypyrrolidin-3-yl]oxyquinoline (PubChem CID 25094492) has the molecular formula C24H26N4O4 and a molecular weight of 434.50 g/mol. Its IUPAC name is 2-[7-(2-methoxyethoxy)imidazo[1,2-a]pyridin-3-yl]-8-[(3R,4R)-4-methoxypyrrolidin-3-yl]oxyquinoline.
| Compound Name | 2-[7-(2-methoxyethoxy)imidazo[1,2-a]pyridin-3-yl]-8-[(3R,4R)-4-methoxypyrrolidin-3-yl]oxyquinoline |
|---|---|
| PubChem CID | 25094492 |
| Molecular Formula | C24H26N4O4 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | 2-[7-(2-methoxyethoxy)imidazo[1,2-a]pyridin-3-yl]-8-[(3R,4R)-4-methoxypyrrolidin-3-yl]oxyquinoline |
| SMILES | COCCOc1ccn2c(-c3ccc4cccc(O[C@@H]5CNC[C@H]5OC)c4n3)cnc2c1 |
| InChI | InChI=1S/C24H26N4O4/c1-29-10-11-31-17-8-9-28-19(13-26-23(28)12-17)18-7-6-16-4-3-5-20(24(16)27-18)32-22-15-25-14-21(22)30-2/h3-9,12-13,21-22,25H,10-11,14-15H2,1-2H3/t21-,22-/m1/s1 |
| InChIKey | NQOAYTFDSNONAL-FGZHOGPDSA-N |
| XLogP | 2.94 |
| TPSA | 79.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|