C21H18FNO11S — CID 25094799
(2S,3S,4S,5R)-6-[[7-ethenyl-2-(3-fluoro-4-sulfophenyl)-1,3-benzoxazol-5-yl]oxy]-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 25094799) has the molecular formula C21H18FNO11S and a molecular weight of 511.44 g/mol. Its IUPAC name is (2S,3S,4S,5R)-6-[[7-ethenyl-2-(3-fluoro-4-sulfophenyl)-1,3-benzoxazol-5-yl]oxy]-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5R)-6-[[7-ethenyl-2-(3-fluoro-4-sulfophenyl)-1,3-benzoxazol-5-yl]oxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 25094799 |
| Molecular Formula | C21H18FNO11S |
| Molecular Weight | 511.44 g/mol |
| Exact Mass | 511.06 |
| IUPAC Name | (2S,3S,4S,5R)-6-[[7-ethenyl-2-(3-fluoro-4-sulfophenyl)-1,3-benzoxazol-5-yl]oxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | C=Cc1cc(OC2O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]2O)cc2nc(-c3ccc(S(=O)(=O)O)c(F)c3)oc12 |
| InChI | InChI=1S/C21H18FNO11S/c1-2-8-5-10(32-21-16(26)14(24)15(25)18(34-21)20(27)28)7-12-17(8)33-19(23-12)9-3-4-13(11(22)6-9)35(29,30)31/h2-7,14-16,18,21,24-26H,1H2,(H,27,28)(H,29,30,31)/t14-,15-,16+,18-,21?/m0/s1 |
| InChIKey | UXLNEKTVFNIAAN-YSAJFMKNSA-N |
| XLogP | 0.79 |
| TPSA | 196.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.44 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|