About 9-bromo-6-[(2-methylpyrazol-3-yl)methylamino]-2H-benzo[c][1,6]naphthyridin-1-one
9-bromo-6-[(2-methylpyrazol-3-yl)methylamino]-2H-benzo[c][1,6]naphthyridin-1-one (PubChem CID 25094963) has the molecular formula C17H14BrN5O
and a molecular weight of 384.24 g/mol. Its IUPAC name is 9-bromo-6-[(2-methylpyrazol-3-yl)methylamino]-2H-benzo[c][1,6]naphthyridin-1-one.
Molecular Properties
| Compound Name | 9-bromo-6-[(2-methylpyrazol-3-yl)methylamino]-2H-benzo[c][1,6]naphthyridin-1-one |
| PubChem CID | 25094963 |
| Molecular Formula | C17H14BrN5O |
| Molecular Weight | 384.24 g/mol |
| Exact Mass | 383.04 |
| IUPAC Name | 9-bromo-6-[(2-methylpyrazol-3-yl)methylamino]-2H-benzo[c][1,6]naphthyridin-1-one |
| SMILES | Cn1nccc1CNc1nc2cc[nH]c(=O)c2c2cc(Br)ccc12 |
| InChI | InChI=1S/C17H14BrN5O/c1-23-11(4-7-21-23)9-20-16-12-3-2-10(18)8-13(12)15-14(22-16)5-6-19-17(15)24/h2-8H,9H2,1H3,(H,19,24)(H,20,22) |
| InChIKey | DTAKYPQYZLDQDM-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.24 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 9-bromo-6-[(2-methylpyrazol-3-yl)methylamino]-2H-benzo[c][1,6]naphthyridin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-bromo-6-[(2-methylpyrazol-3-yl)methylamino]-2H-benzo[c][1,6]naphthyridin-1-one?
The IUPAC name of 9-bromo-6-[(2-methylpyrazol-3-yl)methylamino]-2H-benzo[c][1,6]naphthyridin-1-one (CID 25094963) is 9-bromo-6-[(2-methylpyrazol-3-yl)methylamino]-2H-benzo[c][1,6]naphthyridin-1-one.
What is the SMILES notation for 9-bromo-6-[(2-methylpyrazol-3-yl)methylamino]-2H-benzo[c][1,6]naphthyridin-1-one?
The canonical SMILES for 9-bromo-6-[(2-methylpyrazol-3-yl)methylamino]-2H-benzo[c][1,6]naphthyridin-1-one is Cn1nccc1CNc1nc2cc[nH]c(=O)c2c2cc(Br)ccc12.
What is the InChIKey of 9-bromo-6-[(2-methylpyrazol-3-yl)methylamino]-2H-benzo[c][1,6]naphthyridin-1-one?
The InChIKey is DTAKYPQYZLDQDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14BrN5O/c1-23-11(4-7-21-23)9-20-16-12-3-2-10(18)8-13(12)15-14(22-16)5-6-19-17(15)24/h2-8H,9H2,1H3,(H,19,24)(H,20,22).
What are the key properties of 9-bromo-6-[(2-methylpyrazol-3-yl)methylamino]-2H-benzo[c][1,6]naphthyridin-1-one?
9-bromo-6-[(2-methylpyrazol-3-yl)methylamino]-2H-benzo[c][1,6]naphthyridin-1-one has a molecular weight of 384.24 g/mol, XLogP of 3.18, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 9-bromo-6-[(2-methylpyrazol-3-yl)methylamino]-2H-benzo[c][1,6]naphthyridin-1-one is sourced from PubChem (CID 25094963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).