C27H26F4N4O4 — CID 25095189
[2-fluoro-4-(trifluoromethoxy)phenyl] 2-amino-4-oxo-3-(1-phenylhex-5-enyl)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylate (PubChem CID 25095189) has the molecular formula C27H26F4N4O4 and a molecular weight of 546.52 g/mol. Its IUPAC name is [2-fluoro-4-(trifluoromethoxy)phenyl] 2-amino-4-oxo-3-(1-phenylhex-5-enyl)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylate.
| Compound Name | [2-fluoro-4-(trifluoromethoxy)phenyl] 2-amino-4-oxo-3-(1-phenylhex-5-enyl)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylate |
|---|---|
| PubChem CID | 25095189 |
| Molecular Formula | C27H26F4N4O4 |
| Molecular Weight | 546.52 g/mol |
| Exact Mass | 546.19 |
| IUPAC Name | [2-fluoro-4-(trifluoromethoxy)phenyl] 2-amino-4-oxo-3-(1-phenylhex-5-enyl)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylate |
| SMILES | C=CCCCC(c1ccccc1)n1c(N)nc2c(c1=O)CCN(C(=O)Oc1ccc(OC(F)(F)F)cc1F)C2 |
| InChI | InChI=1S/C27H26F4N4O4/c1-2-3-5-10-22(17-8-6-4-7-9-17)35-24(36)19-13-14-34(16-21(19)33-25(35)32)26(37)38-23-12-11-18(15-20(23)28)39-27(29,30)31/h2,4,6-9,11-12,15,22H,1,3,5,10,13-14,16H2,(H2,32,33) |
| InChIKey | YATXHHLTHSFJEK-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 99.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.52 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|