About 2-(4-phenoxyphenyl)-N-(2-piperazin-1-ylphenyl)-1,3-thiazole-4-carboxamide
2-(4-phenoxyphenyl)-N-(2-piperazin-1-ylphenyl)-1,3-thiazole-4-carboxamide (PubChem CID 25095483) has the molecular formula C26H24N4O2S
and a molecular weight of 456.57 g/mol. Its IUPAC name is 2-(4-phenoxyphenyl)-N-(2-piperazin-1-ylphenyl)-1,3-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | 2-(4-phenoxyphenyl)-N-(2-piperazin-1-ylphenyl)-1,3-thiazole-4-carboxamide |
| PubChem CID | 25095483 |
| Molecular Formula | C26H24N4O2S |
| Molecular Weight | 456.57 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | 2-(4-phenoxyphenyl)-N-(2-piperazin-1-ylphenyl)-1,3-thiazole-4-carboxamide |
| SMILES | O=C(Nc1ccccc1N1CCNCC1)c1csc(-c2ccc(Oc3ccccc3)cc2)n1 |
| InChI | InChI=1S/C26H24N4O2S/c31-25(28-22-8-4-5-9-24(22)30-16-14-27-15-17-30)23-18-33-26(29-23)19-10-12-21(13-11-19)32-20-6-2-1-3-7-20/h1-13,18,27H,14-17H2,(H,28,31) |
| InChIKey | OUQPMWIHZDHEIU-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 456.57 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(4-phenoxyphenyl)-N-(2-piperazin-1-ylphenyl)-1,3-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-phenoxyphenyl)-N-(2-piperazin-1-ylphenyl)-1,3-thiazole-4-carboxamide?
The IUPAC name of 2-(4-phenoxyphenyl)-N-(2-piperazin-1-ylphenyl)-1,3-thiazole-4-carboxamide (CID 25095483) is 2-(4-phenoxyphenyl)-N-(2-piperazin-1-ylphenyl)-1,3-thiazole-4-carboxamide.
What is the SMILES notation for 2-(4-phenoxyphenyl)-N-(2-piperazin-1-ylphenyl)-1,3-thiazole-4-carboxamide?
The canonical SMILES for 2-(4-phenoxyphenyl)-N-(2-piperazin-1-ylphenyl)-1,3-thiazole-4-carboxamide is O=C(Nc1ccccc1N1CCNCC1)c1csc(-c2ccc(Oc3ccccc3)cc2)n1.
What is the InChIKey of 2-(4-phenoxyphenyl)-N-(2-piperazin-1-ylphenyl)-1,3-thiazole-4-carboxamide?
The InChIKey is OUQPMWIHZDHEIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H24N4O2S/c31-25(28-22-8-4-5-9-24(22)30-16-14-27-15-17-30)23-18-33-26(29-23)19-10-12-21(13-11-19)32-20-6-2-1-3-7-20/h1-13,18,27H,14-17H2,(H,28,31).
What are the key properties of 2-(4-phenoxyphenyl)-N-(2-piperazin-1-ylphenyl)-1,3-thiazole-4-carboxamide?
2-(4-phenoxyphenyl)-N-(2-piperazin-1-ylphenyl)-1,3-thiazole-4-carboxamide has a molecular weight of 456.57 g/mol, XLogP of 5.26, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-phenoxyphenyl)-N-(2-piperazin-1-ylphenyl)-1,3-thiazole-4-carboxamide is sourced from PubChem (CID 25095483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).