C30H33N7O3 — CID 25095802
(E)-1-[3-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-4-morpholin-4-ylbut-2-en-1-one (PubChem CID 25095802) has the molecular formula C30H33N7O3 and a molecular weight of 539.64 g/mol. Its IUPAC name is (E)-1-[3-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-4-morpholin-4-ylbut-2-en-1-one.
| Compound Name | (E)-1-[3-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-4-morpholin-4-ylbut-2-en-1-one |
|---|---|
| PubChem CID | 25095802 |
| Molecular Formula | C30H33N7O3 |
| Molecular Weight | 539.64 g/mol |
| Exact Mass | 539.26 |
| IUPAC Name | (E)-1-[3-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-4-morpholin-4-ylbut-2-en-1-one |
| SMILES | Nc1ncnc2c1c(-c1ccc(Oc3ccccc3)cc1)nn2C1CCCN(C(=O)/C=C/CN2CCOCC2)C1 |
| InChI | InChI=1S/C30H33N7O3/c31-29-27-28(22-10-12-25(13-11-22)40-24-7-2-1-3-8-24)34-37(30(27)33-21-32-29)23-6-4-15-36(20-23)26(38)9-5-14-35-16-18-39-19-17-35/h1-3,5,7-13,21,23H,4,6,14-20H2,(H2,31,32,33)/b9-5+ |
| InChIKey | MADROAFGGPUYNI-WEVVVXLNSA-N |
| XLogP | 3.92 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.64 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|