About methyl 4-(6-fluoro-1H-imidazo[4,5-b]pyridin-2-yl)benzoate
methyl 4-(6-fluoro-1H-imidazo[4,5-b]pyridin-2-yl)benzoate (PubChem CID 25095911) has the molecular formula C14H10FN3O2
and a molecular weight of 271.25 g/mol. Its IUPAC name is methyl 4-(6-fluoro-1H-imidazo[4,5-b]pyridin-2-yl)benzoate.
Molecular Properties
| Compound Name | methyl 4-(6-fluoro-1H-imidazo[4,5-b]pyridin-2-yl)benzoate |
| PubChem CID | 25095911 |
| Molecular Formula | C14H10FN3O2 |
| Molecular Weight | 271.25 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | methyl 4-(6-fluoro-1H-imidazo[4,5-b]pyridin-2-yl)benzoate |
| SMILES | COC(=O)c1ccc(-c2nc3ncc(F)cc3[nH]2)cc1 |
| InChI | InChI=1S/C14H10FN3O2/c1-20-14(19)9-4-2-8(3-5-9)12-17-11-6-10(15)7-16-13(11)18-12/h2-7H,1H3,(H,16,17,18) |
| InChIKey | HAIMSHYWNMSNQI-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.25 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 4-(6-fluoro-1H-imidazo[4,5-b]pyridin-2-yl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-(6-fluoro-1H-imidazo[4,5-b]pyridin-2-yl)benzoate?
The IUPAC name of methyl 4-(6-fluoro-1H-imidazo[4,5-b]pyridin-2-yl)benzoate (CID 25095911) is methyl 4-(6-fluoro-1H-imidazo[4,5-b]pyridin-2-yl)benzoate.
What is the SMILES notation for methyl 4-(6-fluoro-1H-imidazo[4,5-b]pyridin-2-yl)benzoate?
The canonical SMILES for methyl 4-(6-fluoro-1H-imidazo[4,5-b]pyridin-2-yl)benzoate is COC(=O)c1ccc(-c2nc3ncc(F)cc3[nH]2)cc1.
What is the InChIKey of methyl 4-(6-fluoro-1H-imidazo[4,5-b]pyridin-2-yl)benzoate?
The InChIKey is HAIMSHYWNMSNQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10FN3O2/c1-20-14(19)9-4-2-8(3-5-9)12-17-11-6-10(15)7-16-13(11)18-12/h2-7H,1H3,(H,16,17,18).
What are the key properties of methyl 4-(6-fluoro-1H-imidazo[4,5-b]pyridin-2-yl)benzoate?
methyl 4-(6-fluoro-1H-imidazo[4,5-b]pyridin-2-yl)benzoate has a molecular weight of 271.25 g/mol, XLogP of 2.55, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(6-fluoro-1H-imidazo[4,5-b]pyridin-2-yl)benzoate is sourced from PubChem (CID 25095911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).